C24H18Cl2O3 — CID 6316610
(2Z)-2-[(2,6-dichlorophenyl)methylidene]-6-[(2,5-dimethylphenyl)methoxy]-1-benzofuran-3-one (PubChem CID 6316610) has the molecular formula C24H18Cl2O3 and a molecular weight of 425.31 g/mol. Its IUPAC name is (2Z)-2-[(2,6-dichlorophenyl)methylidene]-6-[(2,5-dimethylphenyl)methoxy]-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(2,6-dichlorophenyl)methylidene]-6-[(2,5-dimethylphenyl)methoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 6316610 |
| Molecular Formula | C24H18Cl2O3 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | (2Z)-2-[(2,6-dichlorophenyl)methylidene]-6-[(2,5-dimethylphenyl)methoxy]-1-benzofuran-3-one |
| SMILES | Cc1ccc(C)c(COc2ccc3c(c2)O/C(=C\c2c(Cl)cccc2Cl)C3=O)c1 |
| InChI | InChI=1S/C24H18Cl2O3/c1-14-6-7-15(2)16(10-14)13-28-17-8-9-18-22(11-17)29-23(24(18)27)12-19-20(25)4-3-5-21(19)26/h3-12H,13H2,1-2H3/b23-12- |
| InChIKey | GGRXBHRJLRRXQO-FMCGGJTJSA-N |
| XLogP | 6.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|