C17H9Cl2NO3 — CID 2033056
2-[[(2Z)-2-[(2,6-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetonitrile (PubChem CID 2033056) has the molecular formula C17H9Cl2NO3 and a molecular weight of 346.17 g/mol. Its IUPAC name is 2-[[(2Z)-2-[(2,6-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetonitrile.
| Compound Name | 2-[[(2Z)-2-[(2,6-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetonitrile |
|---|---|
| PubChem CID | 2033056 |
| Molecular Formula | C17H9Cl2NO3 |
| Molecular Weight | 346.17 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 2-[[(2Z)-2-[(2,6-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetonitrile |
| SMILES | N#CCOc1ccc2c(c1)O/C(=C\c1c(Cl)cccc1Cl)C2=O |
| InChI | InChI=1S/C17H9Cl2NO3/c18-13-2-1-3-14(19)12(13)9-16-17(21)11-5-4-10(22-7-6-20)8-15(11)23-16/h1-5,8-9H,7H2/b16-9- |
| InChIKey | HSVPRDLFGBCNSO-SXGWCWSVSA-N |
| XLogP | 4.51 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.17 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|