C23H15NO3 — CID 4861206
2-[[3-oxo-2-[(4-phenylphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetonitrile (PubChem CID 4861206) has the molecular formula C23H15NO3 and a molecular weight of 353.38 g/mol. Its IUPAC name is 2-[[3-oxo-2-[(4-phenylphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetonitrile.
| Compound Name | 2-[[3-oxo-2-[(4-phenylphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetonitrile |
|---|---|
| PubChem CID | 4861206 |
| Molecular Formula | C23H15NO3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 2-[[3-oxo-2-[(4-phenylphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetonitrile |
| SMILES | N#CCOc1ccc2c(c1)OC(=Cc1ccc(-c3ccccc3)cc1)C2=O |
| InChI | InChI=1S/C23H15NO3/c24-12-13-26-19-10-11-20-21(15-19)27-22(23(20)25)14-16-6-8-18(9-7-16)17-4-2-1-3-5-17/h1-11,14-15H,13H2 |
| InChIKey | IFYVGWSQKZEULC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|