C17H9ClFNO3 — CID 3741550
2-[[2-[(2-chloro-6-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetonitrile (PubChem CID 3741550) has the molecular formula C17H9ClFNO3 and a molecular weight of 329.71 g/mol. Its IUPAC name is 2-[[2-[(2-chloro-6-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetonitrile.
| Compound Name | 2-[[2-[(2-chloro-6-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetonitrile |
|---|---|
| PubChem CID | 3741550 |
| Molecular Formula | C17H9ClFNO3 |
| Molecular Weight | 329.71 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 2-[[2-[(2-chloro-6-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetonitrile |
| SMILES | N#CCOc1ccc2c(c1)OC(=Cc1c(F)cccc1Cl)C2=O |
| InChI | InChI=1S/C17H9ClFNO3/c18-13-2-1-3-14(19)12(13)9-16-17(21)11-5-4-10(22-7-6-20)8-15(11)23-16/h1-5,8-9H,7H2 |
| InChIKey | JTQRHZYXZCEZMI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.71 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|