C20H15ClFNO6 — CID 4900457
2-[[2-[[2-[(2-chloro-6-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]propanoic acid (PubChem CID 4900457) has the molecular formula C20H15ClFNO6 and a molecular weight of 419.79 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-chloro-6-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[2-[(2-chloro-6-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 4900457 |
| Molecular Formula | C20H15ClFNO6 |
| Molecular Weight | 419.79 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 2-[[2-[[2-[(2-chloro-6-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetyl]amino]propanoic acid |
| SMILES | CC(NC(=O)COc1ccc2c(c1)OC(=Cc1c(F)cccc1Cl)C2=O)C(=O)O |
| InChI | InChI=1S/C20H15ClFNO6/c1-10(20(26)27)23-18(24)9-28-11-5-6-12-16(7-11)29-17(19(12)25)8-13-14(21)3-2-4-15(13)22/h2-8,10H,9H2,1H3,(H,23,24)(H,26,27) |
| InChIKey | DNJSHACMXGXAJX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.79 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|