C19H13Cl3O4 — CID 6315686
[(2Z)-2-[(2,6-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 4-chlorobutanoate (PubChem CID 6315686) has the molecular formula C19H13Cl3O4 and a molecular weight of 411.67 g/mol. Its IUPAC name is [(2Z)-2-[(2,6-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 4-chlorobutanoate.
| Compound Name | [(2Z)-2-[(2,6-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 4-chlorobutanoate |
|---|---|
| PubChem CID | 6315686 |
| Molecular Formula | C19H13Cl3O4 |
| Molecular Weight | 411.67 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | [(2Z)-2-[(2,6-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 4-chlorobutanoate |
| SMILES | O=C(CCCCl)Oc1ccc2c(c1)O/C(=C\c1c(Cl)cccc1Cl)C2=O |
| InChI | InChI=1S/C19H13Cl3O4/c20-8-2-5-18(23)25-11-6-7-12-16(9-11)26-17(19(12)24)10-13-14(21)3-1-4-15(13)22/h1,3-4,6-7,9-10H,2,5,8H2/b17-10- |
| InChIKey | BBURISIWLUAXLB-YVLHZVERSA-N |
| XLogP | 5.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.67 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|