C21H19ClO5 — CID 5264673
[2-[(2-ethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 4-chlorobutanoate (PubChem CID 5264673) has the molecular formula C21H19ClO5 and a molecular weight of 386.83 g/mol. Its IUPAC name is [2-[(2-ethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 4-chlorobutanoate.
| Compound Name | [2-[(2-ethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 4-chlorobutanoate |
|---|---|
| PubChem CID | 5264673 |
| Molecular Formula | C21H19ClO5 |
| Molecular Weight | 386.83 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | [2-[(2-ethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 4-chlorobutanoate |
| SMILES | CCOc1ccccc1C=C1Oc2cc(OC(=O)CCCCl)ccc2C1=O |
| InChI | InChI=1S/C21H19ClO5/c1-2-25-17-7-4-3-6-14(17)12-19-21(24)16-10-9-15(13-18(16)27-19)26-20(23)8-5-11-22/h3-4,6-7,9-10,12-13H,2,5,8,11H2,1H3 |
| InChIKey | GPVLKIBXSFZSBB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.83 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|