C17H13BrO5 — CID 141359336
7-bromo-2-[(4-hydroxyphenyl)methylidene]-4,6-dimethoxy-1-benzofuran-3-one (PubChem CID 141359336) has the molecular formula C17H13BrO5 and a molecular weight of 377.19 g/mol. Its IUPAC name is 7-bromo-2-[(4-hydroxyphenyl)methylidene]-4,6-dimethoxy-1-benzofuran-3-one.
| Compound Name | 7-bromo-2-[(4-hydroxyphenyl)methylidene]-4,6-dimethoxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 141359336 |
| Molecular Formula | C17H13BrO5 |
| Molecular Weight | 377.19 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | 7-bromo-2-[(4-hydroxyphenyl)methylidene]-4,6-dimethoxy-1-benzofuran-3-one |
| SMILES | COc1cc(OC)c2c(c1Br)OC(=Cc1ccc(O)cc1)C2=O |
| InChI | InChI=1S/C17H13BrO5/c1-21-11-8-12(22-2)15(18)17-14(11)16(20)13(23-17)7-9-3-5-10(19)6-4-9/h3-8,19H,1-2H3 |
| InChIKey | SWZNRUKYVGXQHF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.19 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|