C18H10Br2O4 — CID 171642107
(2Z)-5,7-dibromo-2-[(3-ethynyl-4-hydroxyphenyl)methylidene]-6-methoxy-1-benzofuran-3-one (PubChem CID 171642107) has the molecular formula C18H10Br2O4 and a molecular weight of 450.08 g/mol. Its IUPAC name is (2Z)-5,7-dibromo-2-[(3-ethynyl-4-hydroxyphenyl)methylidene]-6-methoxy-1-benzofuran-3-one.
| Compound Name | (2Z)-5,7-dibromo-2-[(3-ethynyl-4-hydroxyphenyl)methylidene]-6-methoxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 171642107 |
| Molecular Formula | C18H10Br2O4 |
| Molecular Weight | 450.08 g/mol |
| Exact Mass | 447.89 |
| IUPAC Name | (2Z)-5,7-dibromo-2-[(3-ethynyl-4-hydroxyphenyl)methylidene]-6-methoxy-1-benzofuran-3-one |
| SMILES | C#Cc1cc(/C=C2\Oc3c(cc(Br)c(OC)c3Br)C2=O)ccc1O |
| InChI | InChI=1S/C18H10Br2O4/c1-3-10-6-9(4-5-13(10)21)7-14-16(22)11-8-12(19)18(23-2)15(20)17(11)24-14/h1,4-8,21H,2H3/b14-7- |
| InChIKey | ZCEUPKJOSPNWQI-AUWJEWJLSA-N |
| XLogP | 4.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.08 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|