C16H7Br2F3O3 — CID 171642184
(2Z)-5,7-dibromo-2-[[4-hydroxy-3-(trifluoromethyl)phenyl]methylidene]-1-benzofuran-3-one (PubChem CID 171642184) has the molecular formula C16H7Br2F3O3 and a molecular weight of 464.03 g/mol. Its IUPAC name is (2Z)-5,7-dibromo-2-[[4-hydroxy-3-(trifluoromethyl)phenyl]methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-5,7-dibromo-2-[[4-hydroxy-3-(trifluoromethyl)phenyl]methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 171642184 |
| Molecular Formula | C16H7Br2F3O3 |
| Molecular Weight | 464.03 g/mol |
| Exact Mass | 461.87 |
| IUPAC Name | (2Z)-5,7-dibromo-2-[[4-hydroxy-3-(trifluoromethyl)phenyl]methylidene]-1-benzofuran-3-one |
| SMILES | O=C1/C(=C/c2ccc(O)c(C(F)(F)F)c2)Oc2c(Br)cc(Br)cc21 |
| InChI | InChI=1S/C16H7Br2F3O3/c17-8-5-9-14(23)13(24-15(9)11(18)6-8)4-7-1-2-12(22)10(3-7)16(19,20)21/h1-6,22H/b13-4- |
| InChIKey | RWTRQEKQMRBXKJ-PQMHYQBVSA-N |
| XLogP | 5.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.03 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|