C15H7Cl3O3 — CID 171131524
4,7-dichloro-2-[(3-chloro-4-hydroxyphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 171131524) has the molecular formula C15H7Cl3O3 and a molecular weight of 341.58 g/mol. Its IUPAC name is 4,7-dichloro-2-[(3-chloro-4-hydroxyphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | 4,7-dichloro-2-[(3-chloro-4-hydroxyphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 171131524 |
| Molecular Formula | C15H7Cl3O3 |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 339.95 |
| IUPAC Name | 4,7-dichloro-2-[(3-chloro-4-hydroxyphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | O=C1C(=Cc2ccc(O)c(Cl)c2)Oc2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C15H7Cl3O3/c16-8-2-3-9(17)15-13(8)14(20)12(21-15)6-7-1-4-11(19)10(18)5-7/h1-6,19H |
| InChIKey | ATGIGWPFFATNER-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|