C16H11ClO4 — CID 171130256
7-chloro-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 171130256) has the molecular formula C16H11ClO4 and a molecular weight of 302.71 g/mol. Its IUPAC name is 7-chloro-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | 7-chloro-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 171130256 |
| Molecular Formula | C16H11ClO4 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 7-chloro-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | COc1ccc(C=C2Oc3c(Cl)cccc3C2=O)cc1O |
| InChI | InChI=1S/C16H11ClO4/c1-20-13-6-5-9(7-12(13)18)8-14-15(19)10-3-2-4-11(17)16(10)21-14/h2-8,18H,1H3 |
| InChIKey | VHFVHGZRSDLXHD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|