C19H18O5 — CID 71754473
(2Z)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-5,6-dimethoxy-3H-inden-1-one (PubChem CID 71754473) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is (2Z)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-5,6-dimethoxy-3H-inden-1-one.
| Compound Name | (2Z)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-5,6-dimethoxy-3H-inden-1-one |
|---|---|
| PubChem CID | 71754473 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (2Z)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-5,6-dimethoxy-3H-inden-1-one |
| SMILES | COc1ccc(/C=C2/Cc3cc(OC)c(OC)cc3C2=O)cc1O |
| InChI | InChI=1S/C19H18O5/c1-22-16-5-4-11(7-15(16)20)6-13-8-12-9-17(23-2)18(24-3)10-14(12)19(13)21/h4-7,9-10,20H,8H2,1-3H3/b13-6- |
| InChIKey | CZANROICBWKETJ-MLPAPPSSSA-N |
| XLogP | 3.24 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|