C18H15NO5 — CID 138858216
(2Z)-5,6-dimethoxy-2-[(4-nitrophenyl)methylidene]-3H-inden-1-one (PubChem CID 138858216) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is (2Z)-5,6-dimethoxy-2-[(4-nitrophenyl)methylidene]-3H-inden-1-one.
| Compound Name | (2Z)-5,6-dimethoxy-2-[(4-nitrophenyl)methylidene]-3H-inden-1-one |
|---|---|
| PubChem CID | 138858216 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (2Z)-5,6-dimethoxy-2-[(4-nitrophenyl)methylidene]-3H-inden-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)/C(=C\c1ccc([N+](=O)[O-])cc1)C2 |
| InChI | InChI=1S/C18H15NO5/c1-23-16-9-12-8-13(18(20)15(12)10-17(16)24-2)7-11-3-5-14(6-4-11)19(21)22/h3-7,9-10H,8H2,1-2H3/b13-7- |
| InChIKey | NRZJZJKDBFVBRU-QPEQYQDCSA-N |
| XLogP | 3.43 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|