C22H22O5 — CID 54433264
[4-[(5,6-dimethoxy-3-oxo-1H-inden-2-ylidene)methyl]-2,6-dimethylphenyl] acetate (PubChem CID 54433264) has the molecular formula C22H22O5 and a molecular weight of 366.41 g/mol. Its IUPAC name is [4-[(5,6-dimethoxy-3-oxo-1H-inden-2-ylidene)methyl]-2,6-dimethylphenyl] acetate.
| Compound Name | [4-[(5,6-dimethoxy-3-oxo-1H-inden-2-ylidene)methyl]-2,6-dimethylphenyl] acetate |
|---|---|
| PubChem CID | 54433264 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | [4-[(5,6-dimethoxy-3-oxo-1H-inden-2-ylidene)methyl]-2,6-dimethylphenyl] acetate |
| SMILES | COc1cc2c(cc1OC)C(=O)C(=Cc1cc(C)c(OC(C)=O)c(C)c1)C2 |
| InChI | InChI=1S/C22H22O5/c1-12-6-15(7-13(2)22(12)27-14(3)23)8-17-9-16-10-19(25-4)20(26-5)11-18(16)21(17)24/h6-8,10-11H,9H2,1-5H3 |
| InChIKey | WIZJPJWNWYVIPR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|