C24H23NO6S — CID 87200671
(2Z)-5,6-dimethoxy-2-(pyridin-4-ylmethylidene)-3H-inden-1-one;4-methylbenzenesulfonic acid (PubChem CID 87200671) has the molecular formula C24H23NO6S and a molecular weight of 453.52 g/mol. Its IUPAC name is (2Z)-5,6-dimethoxy-2-(pyridin-4-ylmethylidene)-3H-inden-1-one;4-methylbenzenesulfonic acid.
| Compound Name | (2Z)-5,6-dimethoxy-2-(pyridin-4-ylmethylidene)-3H-inden-1-one;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87200671 |
| Molecular Formula | C24H23NO6S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | (2Z)-5,6-dimethoxy-2-(pyridin-4-ylmethylidene)-3H-inden-1-one;4-methylbenzenesulfonic acid |
| SMILES | COc1cc2c(cc1OC)C(=O)/C(=C\c1ccncc1)C2.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C17H15NO3.C7H8O3S/c1-20-15-9-12-8-13(7-11-3-5-18-6-4-11)17(19)14(12)10-16(15)21-2;1-6-2-4-7(5-3-6)11(8,9)10/h3-7,9-10H,8H2,1-2H3;2-5H,1H3,(H,8,9,10)/b13-7-; |
| InChIKey | XBMUWKVHWREIHV-QCCGTXRUSA-N |
| XLogP | 4.16 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|