C17H14N2O3 — CID 70155051
[3-oxo-2-(pyridin-4-ylmethylidene)-1H-inden-5-yl] N-methylcarbamate (PubChem CID 70155051) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is [3-oxo-2-(pyridin-4-ylmethylidene)-1H-inden-5-yl] N-methylcarbamate.
| Compound Name | [3-oxo-2-(pyridin-4-ylmethylidene)-1H-inden-5-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 70155051 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | [3-oxo-2-(pyridin-4-ylmethylidene)-1H-inden-5-yl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1ccc2c(c1)C(=O)C(=Cc1ccncc1)C2 |
| InChI | InChI=1S/C17H14N2O3/c1-18-17(21)22-14-3-2-12-9-13(16(20)15(12)10-14)8-11-4-6-19-7-5-11/h2-8,10H,9H2,1H3,(H,18,21) |
| InChIKey | BBAADFSRGNYJDV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|