C17H14O3 — CID 174901660
6-hydroxy-2-[(4-methoxyphenyl)methylidene]-3H-inden-1-one (PubChem CID 174901660) has the molecular formula C17H14O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 6-hydroxy-2-[(4-methoxyphenyl)methylidene]-3H-inden-1-one.
| Compound Name | 6-hydroxy-2-[(4-methoxyphenyl)methylidene]-3H-inden-1-one |
|---|---|
| PubChem CID | 174901660 |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 6-hydroxy-2-[(4-methoxyphenyl)methylidene]-3H-inden-1-one |
| SMILES | COc1ccc(C=C2Cc3ccc(O)cc3C2=O)cc1 |
| InChI | InChI=1S/C17H14O3/c1-20-15-6-2-11(3-7-15)8-13-9-12-4-5-14(18)10-16(12)17(13)19/h2-8,10,18H,9H2,1H3 |
| InChIKey | JCUMHUYGUXQLNY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|