C14H11N3O2 — CID 175388936
2-[(2-aminopyrimidin-5-yl)methylidene]-6-hydroxy-3H-inden-1-one (PubChem CID 175388936) has the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-[(2-aminopyrimidin-5-yl)methylidene]-6-hydroxy-3H-inden-1-one.
| Compound Name | 2-[(2-aminopyrimidin-5-yl)methylidene]-6-hydroxy-3H-inden-1-one |
|---|---|
| PubChem CID | 175388936 |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-[(2-aminopyrimidin-5-yl)methylidene]-6-hydroxy-3H-inden-1-one |
| SMILES | Nc1ncc(C=C2Cc3ccc(O)cc3C2=O)cn1 |
| InChI | InChI=1S/C14H11N3O2/c15-14-16-6-8(7-17-14)3-10-4-9-1-2-11(18)5-12(9)13(10)19/h1-3,5-7,18H,4H2,(H2,15,16,17) |
| InChIKey | QCMWMDUWKSEFQH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|