C16H10F3NO2 — CID 167437450
(2E)-5-hydroxy-2-[[6-(trifluoromethyl)-3-pyridinyl]methylidene]-3H-inden-1-one (PubChem CID 167437450) has the molecular formula C16H10F3NO2 and a molecular weight of 305.26 g/mol. Its IUPAC name is (2E)-5-hydroxy-2-[[6-(trifluoromethyl)-3-pyridinyl]methylidene]-3H-inden-1-one.
| Compound Name | (2E)-5-hydroxy-2-[[6-(trifluoromethyl)-3-pyridinyl]methylidene]-3H-inden-1-one |
|---|---|
| PubChem CID | 167437450 |
| Molecular Formula | C16H10F3NO2 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | (2E)-5-hydroxy-2-[[6-(trifluoromethyl)-3-pyridinyl]methylidene]-3H-inden-1-one |
| SMILES | O=C1/C(=C/c2ccc(C(F)(F)F)nc2)Cc2cc(O)ccc21 |
| InChI | InChI=1S/C16H10F3NO2/c17-16(18,19)14-4-1-9(8-20-14)5-11-6-10-7-12(21)2-3-13(10)15(11)22/h1-5,7-8,21H,6H2/b11-5+ |
| InChIKey | JAEKSYKCSQGPGJ-VZUCSPMQSA-N |
| XLogP | 3.63 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|