C13H9N3O3 — CID 163286903
(2Z)-2-[(2-aminopyrimidin-5-yl)methylidene]-6-hydroxy-1-benzofuran-3-one (PubChem CID 163286903) has the molecular formula C13H9N3O3 and a molecular weight of 255.23 g/mol. Its IUPAC name is (2Z)-2-[(2-aminopyrimidin-5-yl)methylidene]-6-hydroxy-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(2-aminopyrimidin-5-yl)methylidene]-6-hydroxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 163286903 |
| Molecular Formula | C13H9N3O3 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | (2Z)-2-[(2-aminopyrimidin-5-yl)methylidene]-6-hydroxy-1-benzofuran-3-one |
| SMILES | Nc1ncc(/C=C2\Oc3cc(O)ccc3C2=O)cn1 |
| InChI | InChI=1S/C13H9N3O3/c14-13-15-5-7(6-16-13)3-11-12(18)9-2-1-8(17)4-10(9)19-11/h1-6,17H,(H2,14,15,16)/b11-3- |
| InChIKey | SDDPDJUPYYEHIW-JYOAFUTRSA-N |
| XLogP | 1.38 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|