C19H18O5 — CID 54352699
6-hydroxy-2-[(3-methoxy-4-propoxyphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 54352699) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is 6-hydroxy-2-[(3-methoxy-4-propoxyphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | 6-hydroxy-2-[(3-methoxy-4-propoxyphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 54352699 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 6-hydroxy-2-[(3-methoxy-4-propoxyphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | CCCOc1ccc(C=C2Oc3cc(O)ccc3C2=O)cc1OC |
| InChI | InChI=1S/C19H18O5/c1-3-8-23-15-7-4-12(9-17(15)22-2)10-18-19(21)14-6-5-13(20)11-16(14)24-18/h4-7,9-11,20H,3,8H2,1-2H3 |
| InChIKey | UGWQNZUPNVMPPV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|