C17H14O3 — CID 47241499
(2Z)-2-[(3,4-dimethylphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one (PubChem CID 47241499) has the molecular formula C17H14O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is (2Z)-2-[(3,4-dimethylphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(3,4-dimethylphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 47241499 |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (2Z)-2-[(3,4-dimethylphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one |
| SMILES | Cc1ccc(/C=C2\Oc3cc(O)ccc3C2=O)cc1C |
| InChI | InChI=1S/C17H14O3/c1-10-3-4-12(7-11(10)2)8-16-17(19)14-6-5-13(18)9-15(14)20-16/h3-9,18H,1-2H3/b16-8- |
| InChIKey | YRMZWIREKOQLRT-PXNMLYILSA-N |
| XLogP | 3.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|