C15H8Br2O4 — CID 171131608
2-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one (PubChem CID 171131608) has the molecular formula C15H8Br2O4 and a molecular weight of 412.03 g/mol. Its IUPAC name is 2-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one.
| Compound Name | 2-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 171131608 |
| Molecular Formula | C15H8Br2O4 |
| Molecular Weight | 412.03 g/mol |
| Exact Mass | 409.88 |
| IUPAC Name | 2-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-6-hydroxy-1-benzofuran-3-one |
| SMILES | O=C1C(=Cc2cc(Br)c(O)c(Br)c2)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C15H8Br2O4/c16-10-3-7(4-11(17)15(10)20)5-13-14(19)9-2-1-8(18)6-12(9)21-13/h1-6,18,20H |
| InChIKey | AYCGANSSFCXUQN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.03 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|