C17H12F2O5 — CID 17476607
(2Z)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-6-hydroxy-1-benzofuran-3-one (PubChem CID 17476607) has the molecular formula C17H12F2O5 and a molecular weight of 334.27 g/mol. Its IUPAC name is (2Z)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-6-hydroxy-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-6-hydroxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 17476607 |
| Molecular Formula | C17H12F2O5 |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | (2Z)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-6-hydroxy-1-benzofuran-3-one |
| SMILES | COc1cc(/C=C2\Oc3cc(O)ccc3C2=O)ccc1OC(F)F |
| InChI | InChI=1S/C17H12F2O5/c1-22-14-6-9(2-5-12(14)24-17(18)19)7-15-16(21)11-4-3-10(20)8-13(11)23-15/h2-8,17,20H,1H3/b15-7- |
| InChIKey | BREJAJOZIYDLAE-CHHVJCJISA-N |
| XLogP | 3.62 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|