C24H28O4 — CID 18823848
(2Z)-2-[(4-hexoxy-3-methoxyphenyl)methylidene]-5,6-dimethyl-1-benzofuran-3-one (PubChem CID 18823848) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is (2Z)-2-[(4-hexoxy-3-methoxyphenyl)methylidene]-5,6-dimethyl-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(4-hexoxy-3-methoxyphenyl)methylidene]-5,6-dimethyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 18823848 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | (2Z)-2-[(4-hexoxy-3-methoxyphenyl)methylidene]-5,6-dimethyl-1-benzofuran-3-one |
| SMILES | CCCCCCOc1ccc(/C=C2\Oc3cc(C)c(C)cc3C2=O)cc1OC |
| InChI | InChI=1S/C24H28O4/c1-5-6-7-8-11-27-20-10-9-18(14-22(20)26-4)15-23-24(25)19-12-16(2)17(3)13-21(19)28-23/h9-10,12-15H,5-8,11H2,1-4H3/b23-15- |
| InChIKey | VCXPUSWARMUGJK-HAHDFKILSA-N |
| XLogP | 5.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|