C19H27NO3 — CID 110537750
(3E)-3-[(3-methoxy-4-pentoxyphenyl)methylidene]-1-methylpiperidin-4-one (PubChem CID 110537750) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (3E)-3-[(3-methoxy-4-pentoxyphenyl)methylidene]-1-methylpiperidin-4-one.
| Compound Name | (3E)-3-[(3-methoxy-4-pentoxyphenyl)methylidene]-1-methylpiperidin-4-one |
|---|---|
| PubChem CID | 110537750 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (3E)-3-[(3-methoxy-4-pentoxyphenyl)methylidene]-1-methylpiperidin-4-one |
| SMILES | CCCCCOc1ccc(/C=C2\CN(C)CCC2=O)cc1OC |
| InChI | InChI=1S/C19H27NO3/c1-4-5-6-11-23-18-8-7-15(13-19(18)22-3)12-16-14-20(2)10-9-17(16)21/h7-8,12-13H,4-6,9-11,14H2,1-3H3/b16-12+ |
| InChIKey | JAJHLVCIOMMFCC-FOWTUZBSSA-N |
| XLogP | 3.55 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|