C16H20BrNO2 — CID 110536626
(3E)-3-[(5-bromo-2-methoxyphenyl)methylidene]-1-propylpiperidin-4-one (PubChem CID 110536626) has the molecular formula C16H20BrNO2 and a molecular weight of 338.25 g/mol. Its IUPAC name is (3E)-3-[(5-bromo-2-methoxyphenyl)methylidene]-1-propylpiperidin-4-one.
| Compound Name | (3E)-3-[(5-bromo-2-methoxyphenyl)methylidene]-1-propylpiperidin-4-one |
|---|---|
| PubChem CID | 110536626 |
| Molecular Formula | C16H20BrNO2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | (3E)-3-[(5-bromo-2-methoxyphenyl)methylidene]-1-propylpiperidin-4-one |
| SMILES | CCCN1CCC(=O)/C(=C/c2cc(Br)ccc2OC)C1 |
| InChI | InChI=1S/C16H20BrNO2/c1-3-7-18-8-6-15(19)13(11-18)9-12-10-14(17)4-5-16(12)20-2/h4-5,9-10H,3,6-8,11H2,1-2H3/b13-9+ |
| InChIKey | HKQZQEIPZJCZSL-UKTHLTGXSA-N |
| XLogP | 3.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|