C19H28N2O — CID 110538571
(3E)-3-[[4-(diethylamino)phenyl]methylidene]-1-propylpiperidin-4-one (PubChem CID 110538571) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is (3E)-3-[[4-(diethylamino)phenyl]methylidene]-1-propylpiperidin-4-one.
| Compound Name | (3E)-3-[[4-(diethylamino)phenyl]methylidene]-1-propylpiperidin-4-one |
|---|---|
| PubChem CID | 110538571 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | (3E)-3-[[4-(diethylamino)phenyl]methylidene]-1-propylpiperidin-4-one |
| SMILES | CCCN1CCC(=O)/C(=C/c2ccc(N(CC)CC)cc2)C1 |
| InChI | InChI=1S/C19H28N2O/c1-4-12-20-13-11-19(22)17(15-20)14-16-7-9-18(10-8-16)21(5-2)6-3/h7-10,14H,4-6,11-13,15H2,1-3H3/b17-14+ |
| InChIKey | KAQDBPYTYVYASS-SAPNQHFASA-N |
| XLogP | 3.60 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|