C30H41N3O — CID 54488176
3,5-bis[[4-(diethylamino)phenyl]methylidene]-1-propylpiperidin-4-one (PubChem CID 54488176) has the molecular formula C30H41N3O and a molecular weight of 459.68 g/mol. Its IUPAC name is 3,5-bis[[4-(diethylamino)phenyl]methylidene]-1-propylpiperidin-4-one.
| Compound Name | 3,5-bis[[4-(diethylamino)phenyl]methylidene]-1-propylpiperidin-4-one |
|---|---|
| PubChem CID | 54488176 |
| Molecular Formula | C30H41N3O |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.32 |
| IUPAC Name | 3,5-bis[[4-(diethylamino)phenyl]methylidene]-1-propylpiperidin-4-one |
| SMILES | CCCN1CC(=Cc2ccc(N(CC)CC)cc2)C(=O)C(=Cc2ccc(N(CC)CC)cc2)C1 |
| InChI | InChI=1S/C30H41N3O/c1-6-19-31-22-26(20-24-11-15-28(16-12-24)32(7-2)8-3)30(34)27(23-31)21-25-13-17-29(18-14-25)33(9-4)10-5/h11-18,20-21H,6-10,19,22-23H2,1-5H3 |
| InChIKey | XTVNAAVKODKBKT-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|