C30H30FNO — CID 127027866
(2E,6E)-2-[[4-(diethylamino)phenyl]methylidene]-6-[[4-(4-fluorophenyl)phenyl]methylidene]cyclohexan-1-one (PubChem CID 127027866) has the molecular formula C30H30FNO and a molecular weight of 439.57 g/mol. Its IUPAC name is (2E,6E)-2-[[4-(diethylamino)phenyl]methylidene]-6-[[4-(4-fluorophenyl)phenyl]methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-2-[[4-(diethylamino)phenyl]methylidene]-6-[[4-(4-fluorophenyl)phenyl]methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 127027866 |
| Molecular Formula | C30H30FNO |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | (2E,6E)-2-[[4-(diethylamino)phenyl]methylidene]-6-[[4-(4-fluorophenyl)phenyl]methylidene]cyclohexan-1-one |
| SMILES | CCN(CC)c1ccc(/C=C2\CCC/C(=C\c3ccc(-c4ccc(F)cc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C30H30FNO/c1-3-32(4-2)29-18-10-23(11-19-29)21-27-7-5-6-26(30(27)33)20-22-8-12-24(13-9-22)25-14-16-28(31)17-15-25/h8-21H,3-7H2,1-2H3/b26-20+,27-21+ |
| InChIKey | JCKUVOCCGXUETQ-CRYYDKFDSA-N |
| XLogP | 7.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|