C22H22O — CID 6991055
(6E)-2,6-bis[(4-methylphenyl)methylidene]cyclohexan-1-one (PubChem CID 6991055) has the molecular formula C22H22O and a molecular weight of 302.42 g/mol. Its IUPAC name is (6E)-2,6-bis[(4-methylphenyl)methylidene]cyclohexan-1-one.
| Compound Name | (6E)-2,6-bis[(4-methylphenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 6991055 |
| Molecular Formula | C22H22O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (6E)-2,6-bis[(4-methylphenyl)methylidene]cyclohexan-1-one |
| SMILES | Cc1ccc(C=C2CCC/C(=C\c3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H22O/c1-16-6-10-18(11-7-16)14-20-4-3-5-21(22(20)23)15-19-12-8-17(2)9-13-19/h6-15H,3-5H2,1-2H3/b20-14+,21-15? |
| InChIKey | CETXDHNPPYXEOF-DKSPMQLDSA-N |
| XLogP | 5.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|