C24H26O — CID 46886187
(2E,6E)-2,6-bis[(2,4-dimethylphenyl)methylidene]cyclohexan-1-one (PubChem CID 46886187) has the molecular formula C24H26O and a molecular weight of 330.47 g/mol. Its IUPAC name is (2E,6E)-2,6-bis[(2,4-dimethylphenyl)methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-2,6-bis[(2,4-dimethylphenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 46886187 |
| Molecular Formula | C24H26O |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (2E,6E)-2,6-bis[(2,4-dimethylphenyl)methylidene]cyclohexan-1-one |
| SMILES | Cc1ccc(/C=C2\CCC/C(=C\c3ccc(C)cc3C)C2=O)c(C)c1 |
| InChI | InChI=1S/C24H26O/c1-16-8-10-20(18(3)12-16)14-22-6-5-7-23(24(22)25)15-21-11-9-17(2)13-19(21)4/h8-15H,5-7H2,1-4H3/b22-14+,23-15+ |
| InChIKey | CKJNYOWNHKTLJP-HOFJZWJUSA-N |
| XLogP | 6.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|