C21H18F2O — CID 6308455
(2E,7E)-2,7-bis[(4-fluorophenyl)methylidene]cycloheptan-1-one (PubChem CID 6308455) has the molecular formula C21H18F2O and a molecular weight of 324.37 g/mol. Its IUPAC name is (2E,7E)-2,7-bis[(4-fluorophenyl)methylidene]cycloheptan-1-one.
| Compound Name | (2E,7E)-2,7-bis[(4-fluorophenyl)methylidene]cycloheptan-1-one |
|---|---|
| PubChem CID | 6308455 |
| Molecular Formula | C21H18F2O |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (2E,7E)-2,7-bis[(4-fluorophenyl)methylidene]cycloheptan-1-one |
| SMILES | O=C1/C(=C/c2ccc(F)cc2)CCCC/C1=C\c1ccc(F)cc1 |
| InChI | InChI=1S/C21H18F2O/c22-19-9-5-15(6-10-19)13-17-3-1-2-4-18(21(17)24)14-16-7-11-20(23)12-8-16/h5-14H,1-4H2/b17-13+,18-14+ |
| InChIKey | FFITWFGJIYMKRY-HBKJEHTGSA-N |
| XLogP | 5.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|