C20H18F2NO+ — CID 3564828
3,5-bis[(4-fluorophenyl)methylidene]-1-methylpiperidin-1-ium-4-one (PubChem CID 3564828) has the molecular formula C20H18F2NO+ and a molecular weight of 326.37 g/mol. Its IUPAC name is 3,5-bis[(4-fluorophenyl)methylidene]-1-methylpiperidin-1-ium-4-one.
| Compound Name | 3,5-bis[(4-fluorophenyl)methylidene]-1-methylpiperidin-1-ium-4-one |
|---|---|
| PubChem CID | 3564828 |
| Molecular Formula | C20H18F2NO+ |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 3,5-bis[(4-fluorophenyl)methylidene]-1-methylpiperidin-1-ium-4-one |
| SMILES | C[NH+]1CC(=Cc2ccc(F)cc2)C(=O)C(=Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C20H17F2NO/c1-23-12-16(10-14-2-6-18(21)7-3-14)20(24)17(13-23)11-15-4-8-19(22)9-5-15/h2-11H,12-13H2,1H3/p+1 |
| InChIKey | SXSZQZYFQPCCNH-UHFFFAOYSA-O |
| XLogP | 2.53 |
| TPSA | 21.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|