C24H26N3O3+ — CID 2415957
N-[4-[(E)-[(5Z)-5-[(4-acetamidophenyl)methylidene]-1-methyl-4-oxopiperidin-1-ium-3-ylidene]methyl]phenyl]acetamide (PubChem CID 2415957) has the molecular formula C24H26N3O3+ and a molecular weight of 404.49 g/mol. Its IUPAC name is N-[4-[(E)-[(5Z)-5-[(4-acetamidophenyl)methylidene]-1-methyl-4-oxopiperidin-1-ium-3-ylidene]methyl]phenyl]acetamide.
| Compound Name | N-[4-[(E)-[(5Z)-5-[(4-acetamidophenyl)methylidene]-1-methyl-4-oxopiperidin-1-ium-3-ylidene]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 2415957 |
| Molecular Formula | C24H26N3O3+ |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N-[4-[(E)-[(5Z)-5-[(4-acetamidophenyl)methylidene]-1-methyl-4-oxopiperidin-1-ium-3-ylidene]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=C2/C[NH+](C)C/C(=C\c3ccc(NC(C)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H25N3O3/c1-16(28)25-22-8-4-18(5-9-22)12-20-14-27(3)15-21(24(20)30)13-19-6-10-23(11-7-19)26-17(2)29/h4-13H,14-15H2,1-3H3,(H,25,28)(H,26,29)/p+1/b20-12-,21-13+ |
| InChIKey | KCOSHHSXJRGQTJ-AYRZQKSOSA-O |
| XLogP | 2.17 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|