C18H14FNO2S — CID 167810369
N-[4-[(E)-(8-fluoro-4-oxothiochromen-3-ylidene)methyl]phenyl]acetamide (PubChem CID 167810369) has the molecular formula C18H14FNO2S and a molecular weight of 327.38 g/mol. Its IUPAC name is N-[4-[(E)-(8-fluoro-4-oxothiochromen-3-ylidene)methyl]phenyl]acetamide.
| Compound Name | N-[4-[(E)-(8-fluoro-4-oxothiochromen-3-ylidene)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 167810369 |
| Molecular Formula | C18H14FNO2S |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N-[4-[(E)-(8-fluoro-4-oxothiochromen-3-ylidene)methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=C2/CSc3c(F)cccc3C2=O)cc1 |
| InChI | InChI=1S/C18H14FNO2S/c1-11(21)20-14-7-5-12(6-8-14)9-13-10-23-18-15(17(13)22)3-2-4-16(18)19/h2-9H,10H2,1H3,(H,20,21)/b13-9- |
| InChIKey | XDUCNVVJUVIGPS-LCYFTJDESA-N |
| XLogP | 4.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|