C21H21NO2 — CID 17391600
N-[4-[(E)-(5,7-dimethyl-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenyl]acetamide (PubChem CID 17391600) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is N-[4-[(E)-(5,7-dimethyl-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenyl]acetamide.
| Compound Name | N-[4-[(E)-(5,7-dimethyl-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 17391600 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-[4-[(E)-(5,7-dimethyl-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=C2\CCc3c(C)cc(C)cc3C2=O)cc1 |
| InChI | InChI=1S/C21H21NO2/c1-13-10-14(2)19-9-6-17(21(24)20(19)11-13)12-16-4-7-18(8-5-16)22-15(3)23/h4-5,7-8,10-12H,6,9H2,1-3H3,(H,22,23)/b17-12+ |
| InChIKey | KOVNCEPZVSXBAN-SFQUDFHCSA-N |
| XLogP | 4.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|