About 2-[(4-fluorophenyl)methylidene]-5,7-dimethyl-3,4-dihydronaphthalen-1-one
2-[(4-fluorophenyl)methylidene]-5,7-dimethyl-3,4-dihydronaphthalen-1-one (PubChem CID 4851352) has the molecular formula C19H17FO
and a molecular weight of 280.34 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylidene]-5,7-dimethyl-3,4-dihydronaphthalen-1-one.
Molecular Properties
| Compound Name | 2-[(4-fluorophenyl)methylidene]-5,7-dimethyl-3,4-dihydronaphthalen-1-one |
| PubChem CID | 4851352 |
| Molecular Formula | C19H17FO |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-[(4-fluorophenyl)methylidene]-5,7-dimethyl-3,4-dihydronaphthalen-1-one |
| SMILES | Cc1cc(C)c2c(c1)C(=O)C(=Cc1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C19H17FO/c1-12-9-13(2)17-8-5-15(19(21)18(17)10-12)11-14-3-6-16(20)7-4-14/h3-4,6-7,9-11H,5,8H2,1-2H3 |
| InChIKey | PSGHOFJYYMPELV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-fluorophenyl)methylidene]-5,7-dimethyl-3,4-dihydronaphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-fluorophenyl)methylidene]-5,7-dimethyl-3,4-dihydronaphthalen-1-one?
The IUPAC name of 2-[(4-fluorophenyl)methylidene]-5,7-dimethyl-3,4-dihydronaphthalen-1-one (CID 4851352) is 2-[(4-fluorophenyl)methylidene]-5,7-dimethyl-3,4-dihydronaphthalen-1-one.
What is the SMILES notation for 2-[(4-fluorophenyl)methylidene]-5,7-dimethyl-3,4-dihydronaphthalen-1-one?
The canonical SMILES for 2-[(4-fluorophenyl)methylidene]-5,7-dimethyl-3,4-dihydronaphthalen-1-one is Cc1cc(C)c2c(c1)C(=O)C(=Cc1ccc(F)cc1)CC2.
What is the InChIKey of 2-[(4-fluorophenyl)methylidene]-5,7-dimethyl-3,4-dihydronaphthalen-1-one?
The InChIKey is PSGHOFJYYMPELV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FO/c1-12-9-13(2)17-8-5-15(19(21)18(17)10-12)11-14-3-6-16(20)7-4-14/h3-4,6-7,9-11H,5,8H2,1-2H3.
What are the key properties of 2-[(4-fluorophenyl)methylidene]-5,7-dimethyl-3,4-dihydronaphthalen-1-one?
2-[(4-fluorophenyl)methylidene]-5,7-dimethyl-3,4-dihydronaphthalen-1-one has a molecular weight of 280.34 g/mol, XLogP of 4.66, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-fluorophenyl)methylidene]-5,7-dimethyl-3,4-dihydronaphthalen-1-one is sourced from PubChem (CID 4851352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).