C21H20O3 — CID 2697291
(2E)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-5,7-dimethyl-3,4-dihydronaphthalen-1-one (PubChem CID 2697291) has the molecular formula C21H20O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2E)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-5,7-dimethyl-3,4-dihydronaphthalen-1-one.
| Compound Name | (2E)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-5,7-dimethyl-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 2697291 |
| Molecular Formula | C21H20O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | (2E)-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-5,7-dimethyl-3,4-dihydronaphthalen-1-one |
| SMILES | Cc1cc(C)c2c(c1)C(=O)/C(=C/c1ccc3c(c1)OCCO3)CC2 |
| InChI | InChI=1S/C21H20O3/c1-13-9-14(2)17-5-4-16(21(22)18(17)10-13)11-15-3-6-19-20(12-15)24-8-7-23-19/h3,6,9-12H,4-5,7-8H2,1-2H3/b16-11+ |
| InChIKey | FQAOJPCOIXIWPE-LFIBNONCSA-N |
| XLogP | 4.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|