C24H24NO5+ — CID 7789023
(3Z,5E)-3,5-bis(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-1-methylpiperidin-1-ium-4-one (PubChem CID 7789023) has the molecular formula C24H24NO5+ and a molecular weight of 406.46 g/mol. Its IUPAC name is (3Z,5E)-3,5-bis(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-1-methylpiperidin-1-ium-4-one.
| Compound Name | (3Z,5E)-3,5-bis(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-1-methylpiperidin-1-ium-4-one |
|---|---|
| PubChem CID | 7789023 |
| Molecular Formula | C24H24NO5+ |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (3Z,5E)-3,5-bis(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-1-methylpiperidin-1-ium-4-one |
| SMILES | C[NH+]1C/C(=C/c2ccc3c(c2)OCCO3)C(=O)/C(=C/c2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C24H23NO5/c1-25-14-18(10-16-2-4-20-22(12-16)29-8-6-27-20)24(26)19(15-25)11-17-3-5-21-23(13-17)30-9-7-28-21/h2-5,10-13H,6-9,14-15H2,1H3/p+1/b18-10-,19-11+ |
| InChIKey | MSASXWIULNKTSS-OMYAATJGSA-O |
| XLogP | 1.79 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|