C25H22O7 — CID 167777556
(3Z,5E)-3,5-bis(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-4-oxocyclohexane-1-carboxylic acid (PubChem CID 167777556) has the molecular formula C25H22O7 and a molecular weight of 434.44 g/mol. Its IUPAC name is (3Z,5E)-3,5-bis(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-4-oxocyclohexane-1-carboxylic acid.
| Compound Name | (3Z,5E)-3,5-bis(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-4-oxocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 167777556 |
| Molecular Formula | C25H22O7 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (3Z,5E)-3,5-bis(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-4-oxocyclohexane-1-carboxylic acid |
| SMILES | O=C1/C(=C\c2ccc3c(c2)OCCO3)CC(C(=O)O)C/C1=C\c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C25H22O7/c26-24-17(9-15-1-3-20-22(11-15)31-7-5-29-20)13-19(25(27)28)14-18(24)10-16-2-4-21-23(12-16)32-8-6-30-21/h1-4,9-12,19H,5-8,13-14H2,(H,27,28)/b17-9-,18-10+ |
| InChIKey | JOFPYDZDEBTMOW-BUOZRGFLSA-N |
| XLogP | 3.76 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|