C14H11NO6 — CID 110458312
2-[(3E)-3-(1,3-benzodioxol-5-ylmethylidene)-2,5-dioxopyrrolidin-1-yl]acetic acid (PubChem CID 110458312) has the molecular formula C14H11NO6 and a molecular weight of 289.24 g/mol. Its IUPAC name is 2-[(3E)-3-(1,3-benzodioxol-5-ylmethylidene)-2,5-dioxopyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[(3E)-3-(1,3-benzodioxol-5-ylmethylidene)-2,5-dioxopyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 110458312 |
| Molecular Formula | C14H11NO6 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2-[(3E)-3-(1,3-benzodioxol-5-ylmethylidene)-2,5-dioxopyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C/C(=C\c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C14H11NO6/c16-12-5-9(14(19)15(12)6-13(17)18)3-8-1-2-10-11(4-8)21-7-20-10/h1-4H,5-7H2,(H,17,18)/b9-3+ |
| InChIKey | RXCXBGQSOWMPRR-YCRREMRBSA-N |
| XLogP | 0.64 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|