4-(1,3-benzodioxol-5-ylmethylidene)piperidine-1-carboxylic acid

C14H15NO4 — CID 151428505

IUPAC4-(1,3-benzodioxol-5-ylmethylidene)piperidine-1-carboxylic acid
SMILESO=C(O)N1CCC(=Cc2ccc3c(c2)OCO3)CC1
InChIInChI=1S/C14H15NO4/c16-14(17)15-5-3-10(4-6-15)7-11-1-2-12-13(8-11)19-9-18-12/h1-2,7-8H,3-6,9H2,(H,16,17)
InChIKeyPCAFSXCSVQMCGL-UHFFFAOYSA-N
MW261.28 g/mol
LogP2.57
Rot. Bonds1

About 4-(1,3-benzodioxol-5-ylmethylidene)piperidine-1-carboxylic acid

4-(1,3-benzodioxol-5-ylmethylidene)piperidine-1-carboxylic acid (PubChem CID 151428505) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethylidene)piperidine-1-carboxylic acid.

Molecular Properties

Compound Name4-(1,3-benzodioxol-5-ylmethylidene)piperidine-1-carboxylic acid
PubChem CID151428505
Molecular FormulaC14H15NO4
Molecular Weight261.28 g/mol
Exact Mass261.10
IUPAC Name4-(1,3-benzodioxol-5-ylmethylidene)piperidine-1-carboxylic acid
SMILESO=C(O)N1CCC(=Cc2ccc3c(c2)OCO3)CC1
InChIInChI=1S/C14H15NO4/c16-14(17)15-5-3-10(4-6-15)7-11-1-2-12-13(8-11)19-9-18-12/h1-2,7-8H,3-6,9H2,(H,16,17)
InChIKeyPCAFSXCSVQMCGL-UHFFFAOYSA-N
XLogP2.57
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.28
LogP ≤ 52.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(1,3-benzodioxol-5-ylmethylidene)piperidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,3-benzodioxol-5-ylmethylidene)piperidine-1-carboxylic acid?
The IUPAC name of 4-(1,3-benzodioxol-5-ylmethylidene)piperidine-1-carboxylic acid (CID 151428505) is 4-(1,3-benzodioxol-5-ylmethylidene)piperidine-1-carboxylic acid.
What is the SMILES notation for 4-(1,3-benzodioxol-5-ylmethylidene)piperidine-1-carboxylic acid?
The canonical SMILES for 4-(1,3-benzodioxol-5-ylmethylidene)piperidine-1-carboxylic acid is O=C(O)N1CCC(=Cc2ccc3c(c2)OCO3)CC1.
What is the InChIKey of 4-(1,3-benzodioxol-5-ylmethylidene)piperidine-1-carboxylic acid?
The InChIKey is PCAFSXCSVQMCGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO4/c16-14(17)15-5-3-10(4-6-15)7-11-1-2-12-13(8-11)19-9-18-12/h1-2,7-8H,3-6,9H2,(H,16,17).
What are the key properties of 4-(1,3-benzodioxol-5-ylmethylidene)piperidine-1-carboxylic acid?
4-(1,3-benzodioxol-5-ylmethylidene)piperidine-1-carboxylic acid has a molecular weight of 261.28 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzodioxol-5-ylmethylidene)piperidine-1-carboxylic acid is sourced from PubChem (CID 151428505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).