C13H14O3 — CID 6447014
(2E)-2-(1,3-benzodioxol-5-ylmethylidene)cyclopentan-1-ol (PubChem CID 6447014) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (2E)-2-(1,3-benzodioxol-5-ylmethylidene)cyclopentan-1-ol.
| Compound Name | (2E)-2-(1,3-benzodioxol-5-ylmethylidene)cyclopentan-1-ol |
|---|---|
| PubChem CID | 6447014 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (2E)-2-(1,3-benzodioxol-5-ylmethylidene)cyclopentan-1-ol |
| SMILES | OC1CCC/C1=C\c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H14O3/c14-11-3-1-2-10(11)6-9-4-5-12-13(7-9)16-8-15-12/h4-7,11,14H,1-3,8H2/b10-6+ |
| InChIKey | PQLVLMKIYAPVBL-UXBLZVDNSA-N |
| XLogP | 2.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |