C17H16N2O4 — CID 2755549
4-(1,3-benzodioxol-5-ylmethylidene)-1-phenylpyrazolidine-3,5-diol (PubChem CID 2755549) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethylidene)-1-phenylpyrazolidine-3,5-diol.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethylidene)-1-phenylpyrazolidine-3,5-diol |
|---|---|
| PubChem CID | 2755549 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethylidene)-1-phenylpyrazolidine-3,5-diol |
| SMILES | OC1NN(c2ccccc2)C(O)C1=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H16N2O4/c20-16-13(8-11-6-7-14-15(9-11)23-10-22-14)17(21)19(18-16)12-4-2-1-3-5-12/h1-9,16-18,20-21H,10H2 |
| InChIKey | KHEUSHUDNRYPMG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |