C22H15N3O5 — CID 50855075
(5Z)-1-(1,3-benzodioxol-5-yl)-5-[(1-phenylpyrrol-3-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 50855075) has the molecular formula C22H15N3O5 and a molecular weight of 401.38 g/mol. Its IUPAC name is (5Z)-1-(1,3-benzodioxol-5-yl)-5-[(1-phenylpyrrol-3-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-(1,3-benzodioxol-5-yl)-5-[(1-phenylpyrrol-3-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 50855075 |
| Molecular Formula | C22H15N3O5 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | (5Z)-1-(1,3-benzodioxol-5-yl)-5-[(1-phenylpyrrol-3-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccc3c(c2)OCO3)C(=O)/C1=C\c1ccn(-c2ccccc2)c1 |
| InChI | InChI=1S/C22H15N3O5/c26-20-17(10-14-8-9-24(12-14)15-4-2-1-3-5-15)21(27)25(22(28)23-20)16-6-7-18-19(11-16)30-13-29-18/h1-12H,13H2,(H,23,26,28)/b17-10- |
| InChIKey | PFUZFAZDFLEDIA-YVLHZVERSA-N |
| XLogP | 2.87 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|