C22H18N2O9 — CID 126015798
(2S)-2-[4-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid (PubChem CID 126015798) has the molecular formula C22H18N2O9 and a molecular weight of 454.39 g/mol. Its IUPAC name is (2S)-2-[4-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid.
| Compound Name | (2S)-2-[4-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 126015798 |
| Molecular Formula | C22H18N2O9 |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | (2S)-2-[4-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid |
| SMILES | COc1cc(/C=C2\C(=O)NC(=O)N(c3ccc4c(c3)OCO4)C2=O)ccc1O[C@@H](C)C(=O)O |
| InChI | InChI=1S/C22H18N2O9/c1-11(21(27)28)33-16-5-3-12(8-17(16)30-2)7-14-19(25)23-22(29)24(20(14)26)13-4-6-15-18(9-13)32-10-31-15/h3-9,11H,10H2,1-2H3,(H,27,28)(H,23,25,29)/b14-7+/t11-/m0/s1 |
| InChIKey | ZNUAOKFLBJKPRA-NGPAHMQLSA-N |
| XLogP | 1.94 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|