C25H18N2O10 — CID 126389027
5-[[4-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid (PubChem CID 126389027) has the molecular formula C25H18N2O10 and a molecular weight of 506.42 g/mol. Its IUPAC name is 5-[[4-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 126389027 |
| Molecular Formula | C25H18N2O10 |
| Molecular Weight | 506.42 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 5-[[4-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid |
| SMILES | COc1cc(/C=C2\C(=O)NC(=O)N(c3ccc4c(c3)OCO4)C2=O)ccc1OCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C25H18N2O10/c1-33-20-9-13(2-5-17(20)34-11-15-4-7-19(37-15)24(30)31)8-16-22(28)26-25(32)27(23(16)29)14-3-6-18-21(10-14)36-12-35-18/h2-10H,11-12H2,1H3,(H,30,31)(H,26,28,32)/b16-8+ |
| InChIKey | CIKQLKIAYISHOD-LZYBPNLTSA-N |
| XLogP | 2.96 |
| TPSA | 153.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|