C24H17BrN2O8 — CID 126389035
5-[[4-[(E)-[1-(3-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid (PubChem CID 126389035) has the molecular formula C24H17BrN2O8 and a molecular weight of 541.31 g/mol. Its IUPAC name is 5-[[4-[(E)-[1-(3-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-[(E)-[1-(3-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 126389035 |
| Molecular Formula | C24H17BrN2O8 |
| Molecular Weight | 541.31 g/mol |
| Exact Mass | 540.02 |
| IUPAC Name | 5-[[4-[(E)-[1-(3-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid |
| SMILES | COc1cc(/C=C2\C(=O)NC(=O)N(c3cccc(Br)c3)C2=O)ccc1OCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C24H17BrN2O8/c1-33-20-10-13(5-7-18(20)34-12-16-6-8-19(35-16)23(30)31)9-17-21(28)26-24(32)27(22(17)29)15-4-2-3-14(25)11-15/h2-11H,12H2,1H3,(H,30,31)(H,26,28,32)/b17-9+ |
| InChIKey | CMLKWIHMDXPDNW-RQZCQDPDSA-N |
| XLogP | 3.99 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|